home *** CD-ROM | disk | FTP | other *** search
/ Loadstar 200 / 200.d81 / as menu (.txt) < prev    next >
Encoding:
Commodore BASIC  |  2001-01-01  |  3.5 KB  |  59 lines
  1. 5 poke53272,(peek(53272)and240)or4:clr
  2. 6 dv=peek(186):ifdv<8thendv=8
  3. 10 poke53280,4 :poke53281,7:poke54296,0
  4. 12 ps(1)=1318+54272:ps(2)=1505+54272:ps(3)=1527+54272:ps(4)=1720+54272
  5. 15 print"[147]"chr$(142)spc(8)"                        "
  6. 16 print""chr$(142)spc(8)"  all smiles main menu  "
  7. 17 print""chr$(142)spc(8)"                        "
  8. 20 print"               play the game"
  9. 23 print"                     [144][221]"
  10. 25 print"                     [144][221]"
  11. 30 print" run game tutorial  [144][192][219][192]  run maze maker"
  12. 33 print"                     [144][221]"
  13. 35 print"                     [221]"
  14. 40 print"                   quit"
  15. 50 print"    use joystick in port 2 to select"            :poke12288,0
  16. 51 print"           or press 'q' to quit"
  17. 52 gosub1000
  18. 60 on ch goto100,200,300,40000
  19. 70 goto5
  20. 100 print"[158][147]load"+chr$(34)+"as tut"+chr$(34)+","dv
  21. 110 print"run";
  22. 120 poke198,2:poke631,13:poke632,13:end
  23. 200 print"[158][147]load"+chr$(34)+"all smiles"+chr$(34)+","dv
  24. 210 print"run";
  25. 220 poke198,2:poke631,13:poke632,13:end
  26. 300 print"[158][147]load"+chr$(34)+"as maze maker"+chr$(34)+","dv
  27. 310 print"run";
  28. 320 poke198,2:poke631,13:poke632,13:end
  29. 1000 ch=1:c9=2
  30. 2000 gosub3000
  31. 2005 gett$:j=peek(56320)
  32. 2006 ift$="q"thench=4:j=111
  33. 2007 ifj=126thench=2:c9=1:goto2045
  34. 2009 ifj=119thench=3:c9=3:goto2045
  35. 2011 ifj=125thench=4:c9=4:goto2045
  36. 2013 ifj=123thench=1:c9=2:goto2045
  37. 2015 ifj=111thenreturn
  38. 2045 gosub3000
  39. 2100 forg=ps(c9)tops(c9)+18:pokeg,1:next:goto2000
  40. 2200 gosub3000:forg=ps(1)tops(1)+18:pokeg,1:next:goto2005
  41. 2300 gosub3000:forg=ps(3)tops(3)+18:pokeg,1:next:goto2005
  42. 2400 gosub3000:forg=ps(4)tops(4)+18:pokeg,1:next:goto2005
  43. 3000 forg=ps(c9)tops(c9)+18:pokeg,2:next:return
  44. 9999 end
  45. 10000 d=peek(186):n$="as menu":open15,d,15,"s0:"+n$:close15:saven$,d
  46. 10001 verifyn$,d:end
  47. 40000 fori=8to29:poke820+i,i:next:ifdv>8anddv<30thenpoke828,dv:poke820+dv,8
  48. 40010 a$="presenter":gosub40030:a$="hello connect":gosub40030
  49. 40020 print"[147]":poke53272,23:poke186,8:poke2048,0:poke44,8:poke43,1:goto40100
  50. 40030 forj=8to29:i=peek(820+j):ifi=14thennext
  51. 40040 close2:open2,i,2:close2:ifstthen40060
  52. 40050 close15:open15,i,15,"r0:"+a$+"="+a$:input#15,er:close15:ifer=63then40070
  53. 40060 next:return
  54. 40070 a$="hello connect":q$=chr$(34):poke646,peek(53281):print"[147]":poke53272,23
  55. 40080 print"[147]p[207]2048,0:p[207]44,8:p[207]43,1:p[207]56,160:p[207]55,0:clr:l[207]"q$a$q$","i
  56. 40090 print"run:":poke631,13:poke632,13:poke198,2:end
  57. 40100 poke53280,14:poke53281,6:poke646,14:print"[147]":end
  58. 61000 open15,8,15:input#15,en,en$,t,s:close15:printen,en$,t,s
  59.