home *** CD-ROM | disk | FTP | other *** search
/ Loadstar 26 / 026.d81 / as menu (.txt) < prev    next >
Encoding:
Commodore BASIC  |  1986-01-01  |  1.4 KB  |  47 lines
  1. 5 poke53272,(peek(53272)and240)or4:clr
  2. 10 poke53280,4 :poke53281,7:poke54296,0
  3. 12 ps(1)=1318+54272:ps(2)=1505+54272:ps(3)=1527+54272:ps(4)=1720+54272
  4. 15 print"[147]"chr$(142)spc(8)"                        "
  5. 16 print""chr$(142)spc(8)"  all smiles main menu  "
  6. 17 print""chr$(142)spc(8)"                        "
  7. 20 print"               play the game"
  8. 23 print"                     [144][221]"
  9. 25 print"                     [144][221]"
  10. 30 print" run game tutorial  [144][192][219][192]  run maze maker"
  11. 33 print"                     [144][221]"
  12. 35 print"                     [221]"
  13. 40 print"                   quit"
  14. 50 print"    use joystick in port 2 to select"            :poke12288,0
  15. 51 print"           or press 'q' to quit"
  16. 52 gosub1000
  17. 60 on ch goto100,200,300,60000
  18. 70 goto5
  19. 100 print"[147]load"+chr$(34)+"as tut"+chr$(34)+",8"
  20. 110 print"run";
  21. 120 poke198,2:poke631,13:poke632,13:end
  22. 200 print"[147]load"+chr$(34)+"all smiles"+chr$(34)+",8"
  23. 210 print"run";
  24. 220 poke198,2:poke631,13:poke632,13:end
  25. 300 print"[147]load"+chr$(34)+"as maze maker"+chr$(34)+",8"
  26. 310 print"run";
  27. 320 poke198,2:poke631,13:poke632,13:end
  28. 1000 ch=1
  29. 2000 gosub3000
  30. 2005 gett$:j=peek(56320)
  31. 2006 ift$="q"thench=4:j=111
  32. 2007 ifj=126thench=2:goto2050
  33. 2008 rem  ifj=127 then2005
  34. 2009 ifj=119thench=3:goto2050
  35. 2011 ifj=125thench=4:goto2050
  36. 2013 ifj=123thench=1:goto2050
  37. 2015 ifj=111thenreturn
  38. 2050 on ch goto 2100,2200,2300,2400
  39. 2100 gosub3000:forg=ps(2)tops(2)+18:pokeg,1:next:goto2005
  40. 2200 gosub3000:forg=ps(1)tops(1)+18:pokeg,1:next:goto2005
  41. 2300 gosub3000:forg=ps(3)tops(3)+18:pokeg,1:next:goto2005
  42. 2400 gosub3000:forg=ps(4)tops(4)+18:pokeg,1:next:goto2005
  43. 3000 fort=1to4:forg=ps(t)tops(t)+18:pokeg,2:nextg:nextt:return
  44. 60000 open15,8,15,"r0:hello connect=hello connect":input#15,er:close15
  45. 60010 ifer<>63thenend
  46. 60020 load"hello connect",8
  47.